VU 0238429
VU 0238429 is a selective positive allosteric modulator of M5 receptors with EC50 values of 1.16, >30 and >30 μM at M5, M1 and M3 receptors respectively.
| Trivial name | / |
| Catalog Number | CSN24529 |
| Alternative Name(s) | / |
| Research Area | Neurological Disease |
| Molecular Formula | C17H12F3NO4 |
| CAS# | 1160247-92-6 |
| Purity | ≥98% |
| SMILES | O=C1N(CC2=CC=C(OC)C=C2)C3=C(C=C(OC(F)(F)F)C=C3)C1=O |
| Size | 100mg |
| Supplier Page | https://www.csnpharm.com/products/vu-0238429.html |