Moracin C
Moracin C, a natural product isolated and purified from the root bark of Morus alba L., is a potent antibacterial compound which inhibits FabI and fatty acid synthesis.
| Trivial name | Moracin-C |
| Catalog Number | CSN15161 |
| Alternative Name(s) | Moracin-C |
| Research Area | / |
| Molecular Formula | C19H18O4 |
| CAS# | 69120-06-5 |
| Purity | ≥98% |
| SMILES | OC1=CC(C2=CC3=CC=C(O)C=C3O2)=CC(O)=C1C/C=C(C)\C |
| Size | 1mg |
| Supplier Page | https://www.csnpharm.com/products/moracin-c.html |