Senkyunolide H
Senkyunolide H, a natural prototype for an anti-atherosclerotic drug isolated and purified from the roots of Ligusticum chuanxiong hort, can reduce the metamorphose damage of the RBC caused by ConA, and alleviated the aggregation of the RBC.
| Trivial name | Senkyunolide-H |
| Catalog Number | CSN14388 |
| Alternative Name(s) | Senkyunolide-H |
| Research Area | / |
| Molecular Formula | C12H16O4 |
| CAS# | 94596-27-7 |
| Purity | ≥98% |
| SMILES | O=C1O/C(C2=C1[C@H](O)[C@H](O)CC2)=C\CCC |
| Size | 5mg |
| Supplier Page | https://www.csnpharm.com/products/senkyunolide-h.html |