beta-Costic Acid
beta-Costic acid, a natural product isolated and purified from the herb of Dittrichia graveolens, is used against the acari Varroa destructor as parasite of the honey bee.
| Trivial name | β-Costic Acid |
| Catalog Number | CSN14074 |
| Alternative Name(s) | β-Costic Acid |
| Research Area | / |
| Molecular Formula | C15H22O2 |
| CAS# | 3650-43-9 |
| Purity | ≥98% |
| SMILES | C=C([C@H](CC[C@@]1(C)CCC2)C[C@@]1([H])C2=C)C(O)=O |
| Size | 5mg |
| Supplier Page | https://www.csnpharm.com/products/beta-costic-acid.html |