7,4′-Dihydroxy-8-Methylflavan
7,4’Dihydroxy-8-methylflavan, a natural product isolated and purified from the red resin of Dracaena cochinchinensis with free radical scavenging properties, can significantly promote mesenchymal stem cells (MSCs) osteogenic differentiation by increasing the levels of alkaline phosphatase (ALP) activity.
| Trivial name | / |
| Catalog Number | CSN15122 |
| Alternative Name(s) | / |
| Research Area | / |
| Molecular Formula | C16H16O3 |
| CAS# | 82925-55-1 |
| Purity | ≥98% |
| SMILES | OC1=CC=C2CC[C@@H](C3=CC=C(O)C=C3)OC2=C1C |
| Size | 1mg |
| Supplier Page | https://www.csnpharm.com/products/7,4'-dihydroxy-8-methylflavan.html |
