Clofoctol
Clofoctol is a bacteriostatic antibiotic. It is used in the treatment of respiratory tract and ear, nose and throat infections caused by Gram-positive bacteria. It is only functional against Gram-positive bacteria, It penetrates into human lung tissue.
| Trivial name | Octofene |
| Catalog Number | CSN10672 |
| Alternative Name(s) | Octofene |
| Research Area | Infection |
| Molecular Formula | C21H26Cl2O |
| CAS# | 37693-01-9 |
| Purity | ≥98% |
| SMILES | OC1=CC=C(C(C)(C)CC(C)(C)C)C=C1CC2=CC=C(Cl)C=C2Cl |
| Size | 25mg |
| Supplier Page | https://www.csnpharm.com/products/clofoctol.html |