alpha-Toxicarol
alpha-Toxicarol is a natural product isolated and purified from the herbs of Derris trifoliata Lour. exhibiting a marked inhibitory effect on mouse skin tumor promotion in an in vivo two-stage carcinogenesis test.
| Trivial name | α-Toxicarol |
| Catalog Number | CSN14609 |
| Alternative Name(s) | α-Toxicarol |
| Research Area | / |
| Molecular Formula | C23H22O7 |
| CAS# | 82-09-7 |
| Purity | ≥98% |
| SMILES | O=C1[C@]2([H])[C@](COC3=CC(OC)=C(OC)C=C32)([H])OC4=C5C=CC(C)(C)OC5=CC(O)=C14 |
| Size | 1mg |
| Supplier Page | https://www.csnpharm.com/products/alpha-toxicarol.html |