L-Quisqualic Acid
Glutamate receptor agonist acting at AMPA receptors and metabotropic glutamate receptors positively linked to phosphoinositide hydrolysis. Sensitizes neurons in hippocampus to depolarization by L-AP6 (the so called ‘quis’ effect).
Trivial name | / |
Catalog Number | CSN21401 |
Alternative Name(s) | / |
Research Area | / |
Molecular Formula | C5H7N3O5 |
CAS# | 52809-07-1 |
Purity | ≥98% |
SMILES | O=C(O)[C@@H](N)CN(C(N1)=O)OC1=O |
Size | 25mg |
Supplier Page | https://www.csnpharm.com/products/l-quisqualic-acid.html |