N-(2-Hydroxyethyl)adenosine
N-(2-Hydroxyethyl)adenosine has been studied as an anticonvulsant through the activation of adenosine A1 receptor (AA1R). It attenuates cell death induced by H2O2 through antioxidant action.
| Trivial name | 6-Hydroxyethyladenosine; N6-(2-Hydroxyethyl)adenosine; NSC 54251 |
| Catalog Number | CSN25517 |
| Alternative Name(s) | 6-Hydroxyethyladenosine; N6-(2-Hydroxyethyl)adenosine; NSC 54251 |
| Research Area | / |
| Molecular Formula | C12H17N5O5 |
| CAS# | 4338-48-1 |
| Purity | ≥98% |
| SMILES | OCCNC1=NC=NC2=C1N=CN2[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O |
| Size | 50mg |
| Supplier Page | https://www.csnpharm.com/products/(2r,3r,4s,5r)-2-(6-((2-hydroxyethyl)amino)-9h-purin-9-yl)-5-(hydroxymethyl)tetrahydrofuran-3,4-diol.html |