Latanoprost
Latanoprost is a prostaglandin F2alpha analogue and a prostanoid selective FP receptor agonist with an ocular hypertensive effect. Latanoprost increases uveoscleral outflow and thereby reduces intraocular pressure.
| Trivial name | PhXA41 |
| Catalog Number | CSN11273 |
| Alternative Name(s) | PhXA41 |
| Research Area | / |
| Molecular Formula | C26H40O5 |
| CAS# | 130209-82-4 |
| Purity | ≥97% |
| SMILES | O=C(CCC/C=C\C[C@@H]1[C@H]([C@@H](C[C@@H]1O)O)CC[C@H](CCC2=CC=CC=C2)O)OC(C)C |
| Size | 50mg |
| Supplier Page | https://www.csnpharm.com/products/latanoprost.html |