Amarogentin
Amarogentin is a secoiridoid glycoside that is mainly extracted from Swertia and Gentiana roots. Amarogentin exhibits many biological effects, including anti-oxidative, anti-tumour, and anti-diabetic activities. Amarogentin exerts hepatoprotective and immunomodulatory effects. Amarogentin promotes apoptosis, arrests G2/M cell cycle and downregulates of PI3K/Akt/mTOR signalling pathways. Amarogentin exerts beneficial vasculo-metabolic effect by activating AMPK.
| Trivial name | / |
| Catalog Number | CSN27358 |
| Alternative Name(s) | / |
| Research Area | Immunology/Inflammation |
| Molecular Formula | C29H30O13 |
| CAS# | 21018-84-8 |
| Purity | ≥97% |
| SMILES | O=C(C1=C(O)C=C(O)C=C1C2=CC=CC(O)=C2)O[C@H]3[C@H](O[C@H]4[C@H](C=C)[C@@](CCO5)([H])C(C5=O)=CO4)O[C@H](CO)[C@@H](O)[C@@H]3O |
| Size | 10mg |
| Supplier Page | https://www.csnpharm.com/products/amarogentin.html |