5-FAM SE
5-FAM SE is a single isomer, one of the most popular green fluorescent reagents used for labeling peptides, proteins and nucleotides.
| Trivial name | CFSE; 5-Carboxyfluorescein N-Succinimidyl Este |
| Catalog Number | CSN10052 |
| Alternative Name(s) | CFSE; 5-Carboxyfluorescein N-Succinimidyl Este |
| Research Area | / |
| Molecular Formula | C25H15NO9 |
| CAS# | 92557-80-7 |
| Purity | ≥97% |
| SMILES | O=C1OC2(C3=C(OC4=C2C=CC(O)=C4)C=C(O)C=C3)C5=C1C=C(C(ON6C(CCC6=O)=O)=O)C=C5 |
| Size | 100mg |
| Supplier Page | https://www.csnpharm.com/products/5-fam-se.html |