Adavivint
Adavivint is a potent and selective inhibitor of canonical Wnt signaling, with an EC50 of 19.5 nM via a high-throughput TCF/LEF-reporter assay in SW480 colon cancer cells.
| Trivial name | SM04690 |
| Catalog Number | CSN22337 |
| Alternative Name(s) | SM04690 |
| Research Area | Immunology/Inflammation |
| Molecular Formula | C29H24FN7O |
| CAS# | 1467093-03-3 |
| Purity | ≥97% |
| SMILES | CC(C)CC(NC1=CC(C2=CC3=C(NN=C3C(N4)=NC5=C4C=NC=C5C6=CC=CC(F)=C6)C=C2)=CN=C1)=O |
| Size | 50mg |
| Supplier Page | https://www.csnpharm.com/products/adavivint.html |