Tracheloside
Tracheloside, a natural product isolated and purified from the herbs of Trachelospermum jasminoides (Lindl.) Lem., significantly decreases the activity of alkaline phosphatase (AP), an estrogen-inducible marker enzyme, with an IC50 value of 0.31 mg/mL, a level of inhibition comparable to that of tamoxifen (IC50 = 0.43 mg/mL).
| Trivial name | / |
| Catalog Number | CSN19977 |
| Alternative Name(s) | / |
| Research Area | / |
| Molecular Formula | C27H34O12 |
| CAS# | 33464-71-0 |
| Purity | ≥97% |
| SMILES | O=C1OC[C@H](CC2=CC=C(OC)C(OC)=C2)[C@@]1(O)CC3=CC=C(O[C@H]4[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O4)C(OC)=C3 |
| Size | 5mg |
| Supplier Page | https://www.csnpharm.com/products/tracheloside.html |