BT2
BT2 is a BCKDC kinase (BDK) inhibitor with an IC50 of 3.19 μM. BT2 binding to BDK triggers helix movements in the N-terminal domain, resulting in the dissociation of BDK from the branched-chain α-ketoacid dehydrogenase complex (BCKDC). BT2 (compound 4) is also a potent and selective Mcl-1 inhibitor with a Ki value of 59 μM.
| Trivial name | / |
| Catalog Number | CSN27381 |
| Alternative Name(s) | / |
| Research Area | / |
| Molecular Formula | C9H4Cl2O2S |
| CAS# | 34576-94-8 |
| Purity | ≥97% |
| SMILES | O=C(C1=C(Cl)C2=CC=C(Cl)C=C2S1)O |
| Size | 100mg |
| Supplier Page | https://www.csnpharm.com/products/3,6-dichlorobenzo[b]thiophene-2-carboxylic-acid.html |