E3 Ligase Ligand 1A
E3 ligase Ligand 1A is a VH032 derivate for conjugation reactions of PROTAC, which can hijack VHL as the E3 ubiquitin ligase component.
| Trivial name | / |
| Catalog Number | CSN21252 |
| Alternative Name(s) | / |
| Research Area | Cancer |
| Molecular Formula | C23H32N4O3S |
| CAS# | 1948273-02-6 |
| Purity | ≥97% |
| SMILES | C(N1C[C@@H](C[C@H]1C(=O)N[C@H](C1C=CC(C2SC=NC=2C)=CC=1)C)O)(=O)[C@@H](N)C(C)(C)C |
| Size | 100mg |
| Supplier Page | https://www.csnpharm.com/products/e3-ligase-ligand-1a.html |