Phenylacetylglutamine
Phenylacetylglutamine is a product formed by the conjugation of phenylacetate and glutamine. It is a normal constituent of human urine, but other mammals such as the dog, cat, rat, monkey, sheep, and horse do not excrete this compound.
| Trivial name | NSC 203800;Phenylacetyl-L-glutamine |
| Catalog Number | CSN24872 |
| Alternative Name(s) | NSC 203800;Phenylacetyl-L-glutamine |
| Research Area | / |
| Molecular Formula | C13H16N2O4 |
| CAS# | 28047-15-6 |
| Purity | ≥96% |
| SMILES | O=C(O)[C@@H](NC(CC1=CC=CC=C1)=O)CCC(N)=O |
| Size | 50mg |
| Supplier Page | https://www.csnpharm.com/products/phenylacetylglutamine.html |