Cyclosporin C
Cyclosporin C, a natural product isolaed and purified from Acremonium luzulae, is an immunosuppressive cyclic polypeptide drug commonly used post-transplant to prevent graft rejection from the cytotoxic effects of T-cells.
| Trivial name | Cyclosporin-C |
| Catalog Number | CSN16428 |
| Alternative Name(s) | Cyclosporin-C |
| Research Area | / |
| Molecular Formula | C62H111N11O13 |
| CAS# | 59787-61-0 |
| Purity | ≥95% |
| SMILES | C/C=C/C[C@@H](C)[C@H]([C@]1([H])N(C([C@](N(C([C@@H](N(C([C@](N(C([C@H](NC([C@@H](NC([C@H](CC(C)C)N(C)C([C@@](C(C)C)([H])NC([C@H](CC(C)C)N(C)C(CN(C)C([C@@]([C@H](O)C)([H])NC1=O)=O)=O)=O)=O)=O)C)=O)C)=O)C)([H])CC(C)C)=O)C)CC(C)C)=O)C)([H])C(C)C)=O)C)O |
| Size | 50mg |
| Supplier Page | https://www.csnpharm.com/products/cyclosporin-c.html |