TG693
TG693, an orally available inhibitor of CLK1, promotes the skipping of the endogenous mutated exon 31 in Duchenne muscular dystrophy (DMD) patient-derived cells and increased the production of the functional exon 31-skipped dystrophin protein.
| Trivial name | / |
| Catalog Number | CSN20233 |
| Alternative Name(s) | / |
| Research Area | / |
| Molecular Formula | C12H9N3 |
| CAS# | 885272-55-9 |
| Purity | ≥95% |
| SMILES | C12=C(NN=C2)C=CC(C3=CC=NC=C3)=C1 |
| Size | 1g |
| Supplier Page | https://www.csnpharm.com/products/tg693.html |