Dihydroartemisinic acid
Dihydroartemisinic acid is a natural product from Artemisia annua and the main direct precursor of artemisinin, which is a medicinal herb that is widely used to treat Malaria.
| Trivial name | Dihydroqinghao acid |
| Catalog Number | CSN24836 |
| Alternative Name(s) | Dihydroqinghao acid |
| Research Area | / |
| Molecular Formula | C15H24O2 |
| CAS# | 85031-59-0 |
| Purity | ≥95% |
| SMILES | C[C@H]([C@@H]1CC[C@@H](C)[C@]2([H])CCC(C)=C[C@]12[H])C(O)=O |
| Size | 10mg |
| Supplier Page | https://www.csnpharm.com/products/dihydroartemisinic-acid.html |