Cedryl acetate
Cedryl Acetate, an acetylated from cedarwood oil, has been applied to chemistry for its properties as a chiral and cell signaling reagent with antifungal and immunotoxicity functions. It shows α-glucosidase inhibitory activity.
| Trivial name | / |
| Catalog Number | CSN25120 |
| Alternative Name(s) | / |
| Research Area | / |
| Molecular Formula | C17H28O2 |
| CAS# | 77-54-3 |
| Purity | ≥95% |
| SMILES | CC(O[C@@]1(CC[C@]2(C(C)([C@@H]3C[C@]12CC[C@H]3C)C)[H])C)=O |
| Size | 100mg |
| Supplier Page | https://www.csnpharm.com/products/cedryl-acetate.html |