Momordin Ic
Momordin Ic, a natural product isolated and purified from the fruits of Kochia scoparia (L.) Schrad., might represent a potential source of anticancer candidate, by inducing apoptosis through oxidative stress-regulated mitochondrial dysfunction involving the MAPK and PI3K-mediated iNOS and HO-1 pathways.
| Trivial name | Momordin-Ic |
| Catalog Number | CSN11464 |
| Alternative Name(s) | Momordin-Ic |
| Research Area | / |
| Molecular Formula | C41H64O13 |
| CAS# | 96990-18-0 |
| Purity | ≥95% |
| SMILES | O[C@H]([C@H]([C@@H]([C@@H](C(O)=O)O1)O)O[C@H]2[C@@H]([C@H]([C@@H](CO2)O)O)O)[C@@H]1O[C@H]3CC[C@]4(C)[C@@]5([H])CC=C6[C@]7([H])CC(C)(C)CC[C@]7(C(O)=O)CC[C@](C)6[C@@](C)5CC[C@@]4([H])C3(C)C |
| Size | 5mg |
| Supplier Page | https://www.csnpharm.com/products/momordin-ic.html |