Glucoraphanin
Glucoraphanin, a natural product isolated and purified from the seeds of Raphanus sativus L., with antioxidant and chemoprevention activiy, and can ameliorates obesity and insulin resistance through adipose tissue browning and reduction of metabolic endotoxemia in mice.
| Trivial name | Sulforaphane Glucosinolate |
| Catalog Number | CSN11106 |
| Alternative Name(s) | Sulforaphane Glucosinolate |
| Research Area | / |
| Molecular Formula | C12H23NO10S3 |
| CAS# | 21414-41-5 |
| Purity | ≥95% |
| SMILES | OC[C@@H]1[C@@H](O)[C@H](O)[C@@H](O)[C@H](S/C(CCCCS(C)=O)=N\OS(=O)(O)=O)O1 |
| Size | 5mg |
| Supplier Page | https://www.csnpharm.com/products/glucoraphanin.html |