Eriodictyol
Eriodictyol, a flavonoid isolated and purified from the fruits of Citrus sinensis (L.) Osbeck with anti-inflammatory and antioxidant activities, may possess antidiabetic properties through increasing glucose uptake and improving insulin resistance and be a potential therapeutic resource for Atopic dermatitis and an adjunctive agent to control itchiness inAtopic dermatitis.
| Trivial name | / |
| Catalog Number | CSN12276 |
| Alternative Name(s) | / |
| Research Area | Immunology/Inflammation |
| Molecular Formula | C15H12O6 |
| CAS# | 552-58-9 |
| Purity | ≥95% |
| SMILES | O=C1C[C@@H](C2=CC=C(O)C(O)=C2)OC3=CC(O)=CC(O)=C13 |
| Size | 10mg |
| Supplier Page | https://www.csnpharm.com/products/eriodictyol.html |