6-Mercaptopurine-9-β-D-ribofuranoside
6-Mercaptopurine-9-β-D-ribofuranoside is a purine antimetabolite, acts as an anti-adipogenesis agent, downregulates mRNA levels of PPAR γ and C/EBPα, as well as PPAR γ target protein such as LPL, CD36, aP2, and LXRα[1][2].
| Trivial name | 6-Mercaptopurine riboside, 6-Purinethiol riboside, 6-Thioinosine |
| Catalog Number | CSN25514 |
| Alternative Name(s) | 6-Mercaptopurine riboside, 6-Purinethiol riboside, 6-Thioinosine |
| Research Area | Metabolic Disease |
| Molecular Formula | C10H12N4O4S |
| CAS# | 574-25-4 |
| Purity | ≥95% |
| SMILES | OC[C@@H]1[C@H]([C@H]([C@H](N2C=NC3=C2N=CN=C3S)O1)O)O |
| Size | 10mg |
| Supplier Page | https://www.csnpharm.com/products/6-mercaptopurine-9-b-d-ribofuranoside.html |