Talabostat Mesylate
Talabostat mesilate is an orally active, specific inhibitor of dipeptidyl peptidases with IC50 of 1 nM for DPP4, including tumor-associated fibroblast activation protein.
| Trivial name | PT-100 |
| Catalog Number | CSN13509 |
| Alternative Name(s) | PT-100 |
| Research Area | Metabolic Disease |
| Molecular Formula | C10H23BN2O6S |
| CAS# | 150080-09-4 |
| Purity | ≥90% |
| SMILES | CS(=O)(O)=O.CC(C)[C@H](N)C(N1[C@H](B(O)O)CCC1)=O |
| Size | 25mg |
| Supplier Page | https://www.csnpharm.com/products/talabostat-mesylate.html |