(−)-Cotinine
An alkaloid and active metabolite of (±)-nicotine and (–)-nicotine
| Catalog Number | 15314 |
| Alternative Name(s) | NIH 10498 |
| Research Area | Product Type|Biochemicals|Xenobiotic Metabolites||Product Type|Environmental Toxicology|Toxic Agents|Tobacco||Product Type|Natural Products|Alkaloids||Product Type|Small Molecule Modulators|Ion Channel Modulators|Activators||Research Area|Cancer|DNA Damage and Repair||Research Area|Neuroscience|Behavioral Neuroscience|Addiction Research||Research Area|Xenobiotic Metabolism|Cytochrome P450s|CYP2A6||Research Area|Xenobiotic Metabolism|Drug Metabolites |
| Molecular Formula | C10H12N2O |
| CAS# | 486-56-6 |
| Purity | ≥98% |
| Inchi | InChI=1S/C10H12N2O/c1-12-9(4-5-10(12)13)8-3-2-6-11-7-8/h2-3,6-7,9H,4-5H2,1H3/t9-/m0/s1 |
| Inchi Key | UIKROCXWUNQSPJ-VIFPVBQESA-N |
| SMILES | O=C1CC[C@@H](C2=CN=CC=C2)N1C |
| Size | 100 mg |
| Supplier Page | https://www.caymanchem.com/product/15314 |
