PKR-IN-C16
PKR-IN-C16 (imoxin, C16, Imidazolo-oxindole PKR inhibitor C16) is a specific inhibitor of RNA-dependent protein kinase (PKR, Protein Kinase R, EIF2AK2). PKR-IN-C16 prevents apoptosis and IL-1β production in an acute excitotoxic rat model with a neuroinflammatory component.
| Trivial name | imoxin, C16, Imidazolo-oxindole PKR inhibitor C16 |
| Catalog Number | S9668 |
| Molecular Formula | C13H8N4OS |
| CAS# | 608512-97-6 |
| SMILES | C1=CC2=C(C3=C1NC(=O)C3=CC4=CN=CN4)SC=N2 |
| Size | 5mg |
| Supplier Page | http://www.selleckchem.com/products/pkr-in-c16.html |
| Additional Information | https://file.selleck.cn/downloads/struct/s9668-imidazolo-oxindole-pkr-inhibitor-c16-chemical-structure.gif |