1-Methoxy PMS
Methoxy-PMS (1-Methoxy PMS), an active oxygen formation inducer, is a stable electron-transport mediator between NAD(P)H and tetrazolium dyes. Methoxy-PMS receives an electron from NADH or NADPH at the membrane or inside of the cell and passes the electron to the WST-8 that is around the outer cell membrane.
| Trivial name | 1-Methoxy-5-methylphenazinium methyl sulfate |
| Catalog Number | S7770 |
| Molecular Formula | C15H16N2O5S |
| CAS# | 65162-13-2 |
| SMILES | C[N+]1=C2C=CC=C(C2=NC3=CC=CC=C31)OC.COS(=O)(=O)[O-] |
| Size | 25mg |
| Supplier Page | http://www.selleckchem.com/products/1-methoxy-pms-.html |
| Additional Information | https://file.selleck.cn/downloads/struct/1-methoxy-pms-chemical-structure-s7770.gif |