Epertinib hydrochloride
Epertinib hydrochloride (S-222611 hydrochloride) is a potent, orally active, reversible, and selective tyrosine kinase inhibitor of EGFR, HER2 and HER4 with IC50 of 1.48 nM, 7.15 nM and 2.49 nM, respectively. Epertinib hydrochloride (S-222611 hydrochloride) exhibits antitumor activity.
| Trivial name | Epertinib HCl, S-222611 hydrochloride, S-222611 HCl |
| Catalog Number | S6897 |
| Molecular Formula | C30H28Cl2FN5O3 |
| CAS# | 2071195-74-7 |
| SMILES | Cl.CC#CC(=N\OCC1COCCN1)/C2=CC3=C(C=C2)N=CN=C3NC4=CC=C(OCC5=CC(=CC=C5)F)C(=C4)Cl |
| Size | 5mg |
| Supplier Page | http://www.selleckchem.com/products/epertinib-hydrochloride.html |
| Additional Information | https://file.selleck.cn/downloads/struct/s6897-epertinib-hydrochloride-chemical-structure.gif |