RA-190
RA190, a bis-benzylidine piperidon, is a potent, selective and oral effective inhibitor of proteasome ubiquitin receptor RPN13/ADRM1 with anticancer activity. RA190 triggers ER stress response, p53/p21 signaling axis and autophagy in multiple myeloma cells.
| Trivial name | N/A |
| Catalog Number | S6851 |
| Molecular Formula | C28H23Cl5N2O2 |
| CAS# | 1617495-03-0 |
| SMILES | C1C(=CC2=CC(=C(C=C2)Cl)Cl)C(=O)C(=CC3=CC(=C(C=C3)Cl)Cl)CN1C(=O)C(CC4=CC=CC=C4)N.Cl |
| Size | 25mg |
| Supplier Page | http://www.selleckchem.com/products/ra-190.html |
| Additional Information | https://file.selleck.cn/downloads/struct/s6851-ra190-chemical-structure.gif |