Nodakenetin
Nodakenetin (NANI), a plant-derived coumarin isolated from Angelica decursiva, inhibits α-glucosidase, PTP1B, rat lens aldose reductase (RLAR), AChE, BChE, and β-site amyloid precursor protein cleaving enzyme 1 (BACE1). Nodakenetin alters the protein expression of Bax and Bcl-2, and prompts mitochondrial apoptosis. Nodakenetin exhibits anti-tumor activity.
| Trivial name | NANI |
| Catalog Number | S3245 |
| Molecular Formula | C14H14O4 |
| CAS# | 495-32-9 |
| SMILES | CC(C)(O)C1CC2=C(O1)C=C3OC(=O)C=CC3=C2 |
| Size | 1mg |
| Supplier Page | http://www.selleckchem.com/products/nodakenetin.html |
| Additional Information | https://file.selleck.cn/downloads/struct/s3245-nodakenetin-chemical-structure.gif |