Dehydroabietic acid
Dehydroabietic acid (DAA, DHAA), a naturally occurring diterpene resin acid derived from coniferous plants such as Pinus and Picea, displays anti-inflammatory activity via suppression of Src-, Syk-, and TAK1-mediated pathways.
| Trivial name | DAA, DHAA |
| Catalog Number | S3226 |
| Molecular Formula | C20H28O2 |
| CAS# | 1740-19-8 |
| SMILES | CC(C)C1=CC2=C(C=C1)C3(C)CCCC(C)(C3CC2)C(O)=O |
| Size | 1mg |
| Supplier Page | http://www.selleckchem.com/products/dehydroabietic-acid.html |
| Additional Information | https://file.selleck.cn/downloads/struct/s3226-dehydroabietic-acid-chemical-structure.gif |