DTNB
DTNB (Ellman’s Reag, Ellmans Reagenz, 5,5′-Dithiobis(2-nitrobenzoic acid), 5,5′-Dithiobis-2-nitrobenzoesäure) is a non-fluorescent probe used to quantify the number or concentration of thiol groups in a sample. DTNB is also an allosteric inhibitor of dengue virus protease (NS2B-NS3pro) and Streptomyces proteases.
| Trivial name | Ellman’s Reag, Ellmans Reagenz, 5,5′-Dithiobis(2-nitrobenzoic acid), 5,5′-Dithiobis-2-nitrobenzoesäure |
| Catalog Number | S2764 |
| Molecular Formula | C14H8N2O8S2 |
| CAS# | 69-78-3 |
| SMILES | C1=CC(=C(C=C1SSC2=CC(=C(C=C2)[N+](=O)[O-])C(=O)O)C(=O)O)[N+](=O)[O-] |
| Size | 500mg |
| Supplier Page | http://www.selleckchem.com/products/dtnb.html |
| Additional Information | https://file.selleck.cn/downloads/struct/s2764-dtnb-chemical-structure.gif |