5-Boc-amino-pentanoic acid
5-Boc-amino-pentanoic acid (Boc-5-aminovaleric acid, Boc-NH-C4-acid, Boc-5-Ava-OH) is a PROTAC linker that belongs to a Alkyl/ether linker. Boc-NH-C4-acid is applicable to the synthesis of PROTAC1, and specifically degrades EED, EZH2, and SUZ12 in the PRC2 Complex.
| Trivial name | Boc-5-aminovaleric acid, Boc-NH-C4-acid, Boc-5-Ava-OH |
| Catalog Number | S1803 |
| Molecular Formula | C10H19NO4 |
| CAS# | 27219-07-4 |
| SMILES | CC(C)(C)OC(=O)NCCCCC(=O)O |
| Size | 100mg |
| Supplier Page | http://www.selleckchem.com/products/boc-nh-c4-acid.html |
| Additional Information | https://file.selleck.cn/downloads/struct/s1803-boc-nh-c4-acid-chemical-structure.gif |