Wilforgine
Wilforgine, one of the major bioactive sesquiterpene alkaloids in Tripterygium wilfordii Hook. F., induces microstructural and ultrastructural changes in the muscles of M. separata larvae, and the sites of action are proposed to be calcium receptors or channels in the muscular system.
| Trivial name | N/A |
| Catalog Number | S0973 |
| Molecular Formula | C20H20ClNO5 |
| CAS# | 37239-47-7 |
| Inchi | #N/A |
| Inchi Key | #N/A |
| SMILES | O.[Cl-].COC1=C(OC)C2=C[N+]3=C(C=C2C=C1)C4=CC5=C(OCO5)C=C4CC3 |
| Size | 1mg |
| Supplier Page | http://www.selleckchem.com/products/wilforgine.html |
| Additional Information | https://file.selleck.cn/downloads/struct/s0973-wilforgine-chemical-structure.gif |
