Butyl isobutyl phthalate
Butyl isobutyl phthalate (BIP), isolated from the rhizoid of Laminaria japonica, is a non-competitive inhibitor of α-glucosidase with IC50 of 38 μM. Butyl isobutyl phthalate displays a significant hypoglycemic effect and has the potential for diabetes treatment.
| Trivial name | BIP |
| Catalog Number | S0553 |
| Molecular Formula | C16H22O4 |
| CAS# | 17851-53-5 |
| SMILES | CCCCOC(=O)C1=CC=CC=C1C(=O)OCC(C)C |
| Size | 25mg |
| Supplier Page | http://www.selleckchem.com/products/butyl-isobutyl-phthalate.html |
| Additional Information | https://file.selleck.cn/downloads/struct/s0553-butyl-isobutyl-phthalate-chemical-structure.gif |