Tyrphostin AG30 (AG30)
Tyrphostin AG30 (AG30), a potent and selective EGFR tyrosine kinase inhibitor, selectively inhibits self renewal induction by c-ErbB, and is able to inhibit activation of STAT5 by c-ErbB in primary erythroblasts.
| Trivial name | N/A |
| Catalog Number | S0324 |
| Molecular Formula | C10H7NO4 |
| CAS# | 122520-79-0 |
| SMILES | C1=CC(=C(C=C1C=C(C#N)C(=O)O)O)O |
| Size | 5mg |
| Supplier Page | http://www.selleckchem.com/products/ag30.html |
| Additional Information | https://file.selleck.cn/downloads/struct/s0324-ag30-chemical-structure.gif |