Bay 41-4109 racemate
BAY 41-4109 racemate (BAY41-4109 Racemic) is a mixture of R-isomer of BAY 41-4109 and S-isomer of BAY 41-4109. BAY 41-4109 an antiviral compound that inhibits human hepatitis B virus (HBV) with IC50 of 53 nM.
| Trivial name | BAY41-4109 Racemic |
| Catalog Number | S0285 |
| Molecular Formula | C18H13ClF3N3O2 |
| CAS# | 298708-79-9 |
| SMILES | CC1=C(C(N=C(N1)C2=C(C=C(C=N2)F)F)C3=C(C=C(C=C3)F)Cl)C(=O)OC |
| Size | 5mg |
| Supplier Page | http://www.selleckchem.com/products/bay41-4109-racemic.html |
| Additional Information | https://file.selleck.cn/downloads/struct/S0285-Bay-41-4109-racemate-chemical-structure-.gif |