E260
E260 (Fer and FerT inhibitor E260) is a Fer kinase and FerT inhibitor that selectively evokes metabolic stress in cancer cells by imposing mitochondrial dysfunction and deformation, and onset of energy-consuming autophagy which decreases the cellular ATP level.
| Trivial name | Fer and FerT inhibitor E260 |
| Catalog Number | S0012 |
| Molecular Formula | C24H34N6S |
| CAS# | 1241537-79-0 |
| SMILES | CC(C)C1=CC=C(C=C1)C2=CN3C(=N2)SC(=N3)N4CCC(CC4)CN5CCN(CC5)C |
| Size | 5mg |
| Supplier Page | http://www.selleckchem.com/products/e260.html |
| Additional Information | https://file.selleck.cn/downloads/struct/s0012-fer-and-fert-inhibitor-chemical-structure.gif |