β-Naphthoflavone-CH2-OH
β-Naphthoflavone-CH2-OH (β-NF-CH2-OH) serves as an AhR E3 ligase ligand, forming chimeric molecules when connected to a protein ligand through a linker, resulting in PROTACs or SNIPERs (e.g., β-naphthoflavone-JQ1). These chimeric molecules recruit the AhR E3 ligase complex by incorporating AhR ligands. By inducing ubiquitination-mediated degradation, PROTACs effectively target and degrade cancer-promoting proteins [1].
| Catalog Number | T17363 |
| Alternative Name(s) | β-NF-CH2-OH |
| Research Area | Others |
| Molecular Formula | C20H14O3 |
| CAS# | T17363 |
| SMILES | O=C1C=C(C2=CC=C(CO)C=C2)OC3=C1C4=CC=CC=C4C=C3 |
| Size | 100 mg |
| Supplier Page | https://www.targetmol.com/compound/β-Naphthoflavone-CH2-OH |
| Additional Information | https://www.targetmol.com/datasheet/T17363 |
