(+)-Medicarpin
(+)-Medicarpin, a pterocarpan, is an isoflavonoid compound derived from multiple medicinal plant species such as Sophora japonica, Zollernia paraensis, Platymiscium yucatamun, Machaerium aristulatum, and Platymiscium floribundum. It exhibits potent inhibition of osteoclastogenesis and facilitates bone healing and increased bone mass through osteoblast differentiation, which is mediated by the estrogen receptor (ER) β.
| Catalog Number | T13768 |
| Research Area | Endocrinology/Hormones |
| Molecular Formula | C16H14O4 |
| CAS# | 33983-39-0 |
| Purity | 97.80% |
| SMILES | COc1cc(O[C@@H]2c(ccc(O)c3)c3OC[C@H]22)c2cc1 |
| Size | 100 mg |
| Supplier Page | https://www.targetmol.com/compound/(+)-Medicarpin |
| Additional Information | https://www.targetmol.com/datasheet/T13768 |
