(+)-CBI-CDPI2
(+)-CBI-CDPI2 is an enhanced functional analog of CC-1065.
| Catalog Number | T10701 |
| Research Area | Others |
| Molecular Formula | C36H28N6O4 |
| CAS# | 128300-15-2 |
| SMILES | C(=O)(N1C=2[C@]3([C@](C3)(C1)[H])C=4C(C(=O)C2)=CC=CC4)C5=CC6=C(N5)C=CC7=C6CCN7C(=O)C8=CC9=C(N8)C=CC%10=C9CCN%10C(N)=O |
| Size | 100 mg |
| Supplier Page | https://www.targetmol.com/compound/(+)-CBI-CDPI2 |
| Additional Information | https://www.targetmol.com/datasheet/T10701 |
