Quercetin 3-O-sambubioside
Quercetin 3-Sambubioside has a role as an antioxidant and a plant metabolite. It is a quercetin O-glucoside, a disaccharide derivative and a tetrahydroxyflavone.
| Catalog Number | TN2340 |
| Alternative Name(s) | Quercetin 3-Sambubioside |
| Research Area | Others |
| Molecular Formula | C26H28O16 |
| CAS# | 83048-35-5 |
| SMILES | O(C1=C(OC=2C(C1=O)=C(O)C=C(O)C2)C3=CC(O)=C(O)C=C3)[C@H]4[C@H](O[C@H]5[C@H](O)[C@@H](O)[C@H](O)CO5)[C@@H](O)[C@H](O)[C@@H](CO)O4 |
| Size | 1 mg |
| Supplier Page | https://www.targetmol.com/compound/Quercetin 3-O-sambubioside |
| Additional Information | https://www.targetmol.com/datasheet/TN2340 |