Avitinib (Abivertinib)
Avitinib (Abivertinib) is a pyrrolopyrimidine-based irreversible EGFR inhibitor that is mutation-selective with IC50 value of 0.18 nM against EGFR L858R/T790M double mutations, nearly 43-fold greater potency over wild-type EGFR (IC50 value, 7.68 nM). It has comparable anti-tumor activity and tolerated toxicity.
| Trivial name | AC0010 |
| Catalog Number | S8741 |
| Molecular Formula | C26H26FN7O2 |
| CAS# | 1557267-42-1 |
| Inchi | InChI=1S/C26H26FN7O2/c1-3-23(35)29-17-5-4-6-19(15-17)36-25-20-9-10-28-24(20)31-26(32-25)30-18-7-8-22(21(27)16-18)34-13-11-33(2)12-14-34/h3-10,15-16H,1,11-14H2,2H3,(H,29,35)(H2,28,30,31,32) |
| Inchi Key | UOFYSRZSLXWIQB-UHFFFAOYSA-N |
| SMILES | CN1CCN(CC1)C2=C(C=C(C=C2)NC3=NC4=C(C=CN4)C(=N3)OC5=CC=CC(=C5)NC(=O)C=C)F |
| Size | 5mg |
| Supplier Page | http://www.selleckchem.com/products/avitinib-ac0010.html |
| Additional Information | https://file.selleck.cn/downloads/struct/avitinib-ac0010-chemical-structure-s8741.gif |