PDGFR inhibitor 1
PDGFR inhibitor 1 is an orally bioavailable switch pocket control inhibitor of wild-type and mutated forms of Kit (c-Kit) and PDGFR with potential antineoplastic activity. It also inhibits several other kinases, including VEGFR2, TIE2, PDGFR-beta and CSF1R, thereby further inhibiting tumor cell growth.
| Trivial name | N/A |
| Catalog Number | S8721 |
| Molecular Formula | C26H21F2N5O3 |
| CAS# | 1225278-16-9 |
| Inchi | InChI=1S/C26H21F2N5O3/c1-33-15-16(14-30-33)21-11-18(7-10-29-21)36-23-13-19(27)22(12-20(23)28)32-25(35)26(8-9-26)24(34)31-17-5-3-2-4-6-17/h2-7,10-15H,8-9H2,1H3,(H,31,34)(H,32,35) |
| Inchi Key | WWOXKWLDMLMYQY-UHFFFAOYSA-N |
| SMILES | CN1C=C(C=N1)C2=NC=CC(=C2)OC3=C(C=C(C(=C3)F)NC(=O)C4(CC4)C(=O)NC5=CC=CC=C5)F |
| Size | 5mg |
| Supplier Page | http://www.selleckchem.com/products/pdgfr-inhibitor-1.html |
| Additional Information | https://file.selleck.cn/downloads/struct/dcc-2618-chemical-structure-s8721.gif |