Hydroxyfasudil HCl
Hydroxyfasudil HCl, an active metabolite of fasudil hydrochloride, is a specific Rho-kinase(ROCK) inhibitor with IC50 values of 0.73 μM and 0.72 μM for ROCK1 and ROCK2, respectively.
| Trivial name | HA-1100 |
| Catalog Number | S8208 |
| Molecular Formula | C14H17N3O3S·HCl·xH2O |
| CAS# | 155558-32-0 |
| SMILES | C1CNCCN(C1)S(=O)(=O)C2=CC=CC3=C2C=CNC3=O.Cl |
| Size | 25mg |
| Supplier Page | http://www.selleckchem.com/products/hydroxyfasudil-ha-1100.html |
| Additional Information | https://file.selleck.cn/downloads/struct/hydroxyfasudil-ha-1100-chemical-structure-S8208.gif |