NVP 231
NVP 231 is a novel CerK inhibitor that inhibits the catalytic activity of recombinant CerK in vitro with an IC50 of 12 nM. NVP 231 induces cell apoptosis by increasing DNA fragmentation and caspase-3 and caspase-9 cleavage.
| Trivial name | N/A |
| Catalog Number | S6501 |
| Molecular Formula | C25H25N3O2S |
| CAS# | 362003-83-6 |
| Inchi | InChI=1S/C25H25N3O2S/c29-22(18-4-2-1-3-5-18)28-24-27-20-7-6-19(11-21(20)31-24)26-23(30)25-12-15-8-16(13-25)10-17(9-15)14-25/h1-7,11,15-17H,8-10,12-14H2,(H,26,30)(H,27,28,29) |
| Inchi Key | MVSSJPGNLQPWSW-UHFFFAOYSA-N |
| SMILES | C1C2CC3CC1CC(C2)(C3)C(=O)NC4=CC5=C(C=C4)N=C(S5)NC(=O)C6=CC=CC=C6 |
| Size | 5mg |
| Supplier Page | http://www.selleckchem.com/products/nvp-231.html |
| Additional Information | https://file.selleck.cn/downloads/struct/nvp-231-chemical-structure-s6501.gif |