Zerumbone
Zerumbone, derived from several plant species of the Zingiberaceae family, is a naturally occurring dietary compound and may have multiple biomedical properties, such as antiproliferative, antioxidant, anti-inflammatory, and anticancer activities.
| Trivial name | N/A |
| Catalog Number | S5928 |
| Molecular Formula | C17H20N2O5S |
| CAS# | 471-05-6 |
| Inchi | #N/A |
| Inchi Key | #N/A |
| SMILES | CC(C)ON(CC(=O)NO)[S](=O)(=O)C1=CC=C(C=C1)C2=CC=CC=C2 |
| Size | 25mg |
| Supplier Page | http://www.selleckchem.com/products/zerumbone.html |
| Additional Information | https://file.selleck.cn/downloads/struct/zerumbone-chemical-structure-s5928.gif |