JANEX-1
JANEX-1 (WHI-P131) is a small molecule inhibitor of JAK3 that selectively inhibits JAK3 at an IC50 of 78 µM without altering the activity of JAK1 or JAK2, or any other protein tyrosine kinases (IC50 ≥ 350 µM).
| Trivial name | WHI-P131 |
| Catalog Number | S5903 |
| Molecular Formula | C5H3FN2O4 |
| CAS# | 202475-60-3 |
| Inchi | #N/A |
| Inchi Key | #N/A |
| SMILES | OC(=O)C1=C(F)C(=O)NC(=O)N1 |
| Size | 5mg |
| Supplier Page | http://www.selleckchem.com/products/janex-1.html |
| Additional Information | https://file.selleck.cn/downloads/struct/janex-1-chemical-structure-s5903.gif |